C22H21N5O2S2 — CID 36621894
N-(2,5-dimethylpyrazol-3-yl)-2-(4-oxo-6-phenyl-3-prop-2-enylthieno[3,2-d]pyrimidin-2-yl)sulfanylacetamide (PubChem CID 36621894) has the molecular formula C22H21N5O2S2 and a molecular weight of 451.58 g/mol. Its IUPAC name is N-(2,5-dimethylpyrazol-3-yl)-2-(4-oxo-6-phenyl-3-prop-2-enylthieno[3,2-d]pyrimidin-2-yl)sulfanylacetamide.
| Compound Name | N-(2,5-dimethylpyrazol-3-yl)-2-(4-oxo-6-phenyl-3-prop-2-enylthieno[3,2-d]pyrimidin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 36621894 |
| Molecular Formula | C22H21N5O2S2 |
| Molecular Weight | 451.58 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | N-(2,5-dimethylpyrazol-3-yl)-2-(4-oxo-6-phenyl-3-prop-2-enylthieno[3,2-d]pyrimidin-2-yl)sulfanylacetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2cc(C)nn2C)nc2cc(-c3ccccc3)sc2c1=O |
| InChI | InChI=1S/C22H21N5O2S2/c1-4-10-27-21(29)20-16(12-17(31-20)15-8-6-5-7-9-15)23-22(27)30-13-19(28)24-18-11-14(2)25-26(18)3/h4-9,11-12H,1,10,13H2,2-3H3,(H,24,28) |
| InChIKey | PEGOYISMRLOWRW-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.58 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|