C21H23N3O4 — CID 36626711
methyl 4-[methyl-[3-(5-methylfuran-2-yl)-1-phenylpyrazole-4-carbonyl]amino]butanoate (PubChem CID 36626711) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is methyl 4-[methyl-[3-(5-methylfuran-2-yl)-1-phenylpyrazole-4-carbonyl]amino]butanoate.
| Compound Name | methyl 4-[methyl-[3-(5-methylfuran-2-yl)-1-phenylpyrazole-4-carbonyl]amino]butanoate |
|---|---|
| PubChem CID | 36626711 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | methyl 4-[methyl-[3-(5-methylfuran-2-yl)-1-phenylpyrazole-4-carbonyl]amino]butanoate |
| SMILES | COC(=O)CCCN(C)C(=O)c1cn(-c2ccccc2)nc1-c1ccc(C)o1 |
| InChI | InChI=1S/C21H23N3O4/c1-15-11-12-18(28-15)20-17(14-24(22-20)16-8-5-4-6-9-16)21(26)23(2)13-7-10-19(25)27-3/h4-6,8-9,11-12,14H,7,10,13H2,1-3H3 |
| InChIKey | VTXODFIBQBZHRM-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 77.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |