C7H8N4O2S — CID 3662679
1-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]pyrrolidine-2,5-dione (PubChem CID 3662679) has the molecular formula C7H8N4O2S and a molecular weight of 212.23 g/mol. Its IUPAC name is 1-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 3662679 |
| Molecular Formula | C7H8N4O2S |
| Molecular Weight | 212.23 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | 1-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]pyrrolidine-2,5-dione |
| SMILES | Nc1nnc(CN2C(=O)CCC2=O)s1 |
| InChI | InChI=1S/C7H8N4O2S/c8-7-10-9-4(14-7)3-11-5(12)1-2-6(11)13/h1-3H2,(H2,8,10) |
| InChIKey | CCAFSIXBMLEIJP-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.23 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|