C17H20BrN3O4 — CID 36627249
methyl 4-[3-(6-bromo-4-oxoquinazolin-3-yl)propanoyl-methylamino]butanoate (PubChem CID 36627249) has the molecular formula C17H20BrN3O4 and a molecular weight of 410.27 g/mol. Its IUPAC name is methyl 4-[3-(6-bromo-4-oxoquinazolin-3-yl)propanoyl-methylamino]butanoate.
| Compound Name | methyl 4-[3-(6-bromo-4-oxoquinazolin-3-yl)propanoyl-methylamino]butanoate |
|---|---|
| PubChem CID | 36627249 |
| Molecular Formula | C17H20BrN3O4 |
| Molecular Weight | 410.27 g/mol |
| Exact Mass | 409.06 |
| IUPAC Name | methyl 4-[3-(6-bromo-4-oxoquinazolin-3-yl)propanoyl-methylamino]butanoate |
| SMILES | COC(=O)CCCN(C)C(=O)CCn1cnc2ccc(Br)cc2c1=O |
| InChI | InChI=1S/C17H20BrN3O4/c1-20(8-3-4-16(23)25-2)15(22)7-9-21-11-19-14-6-5-12(18)10-13(14)17(21)24/h5-6,10-11H,3-4,7-9H2,1-2H3 |
| InChIKey | KXUQUCNFAZMLSJ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.27 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |