C19H20FN5O2S — CID 36629629
(3R)-2-(4-fluorophenyl)-5-N-[(6R)-6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]-3,4-dihydropyrazole-3,5-dicarboxamide (PubChem CID 36629629) has the molecular formula C19H20FN5O2S and a molecular weight of 401.47 g/mol. Its IUPAC name is (3R)-2-(4-fluorophenyl)-5-N-[(6R)-6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]-3,4-dihydropyrazole-3,5-dicarboxamide.
| Compound Name | (3R)-2-(4-fluorophenyl)-5-N-[(6R)-6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]-3,4-dihydropyrazole-3,5-dicarboxamide |
|---|---|
| PubChem CID | 36629629 |
| Molecular Formula | C19H20FN5O2S |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | (3R)-2-(4-fluorophenyl)-5-N-[(6R)-6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]-3,4-dihydropyrazole-3,5-dicarboxamide |
| SMILES | C[C@@H]1CCc2nc(NC(=O)C3=NN(c4ccc(F)cc4)[C@@H](C(N)=O)C3)sc2C1 |
| InChI | InChI=1S/C19H20FN5O2S/c1-10-2-7-13-16(8-10)28-19(22-13)23-18(27)14-9-15(17(21)26)25(24-14)12-5-3-11(20)4-6-12/h3-6,10,15H,2,7-9H2,1H3,(H2,21,26)(H,22,23,27)/t10-,15-/m1/s1 |
| InChIKey | DGCXHHUSTXHPKL-MEBBXXQBSA-N |
| XLogP | 2.47 |
| TPSA | 100.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |