C16H16BrNO5 — CID 36632094
1-bromo-2,5-dimethoxy-4-[(5-methyl-2-nitrophenoxy)methyl]benzene (PubChem CID 36632094) has the molecular formula C16H16BrNO5 and a molecular weight of 382.21 g/mol. Its IUPAC name is 1-bromo-2,5-dimethoxy-4-[(5-methyl-2-nitrophenoxy)methyl]benzene.
| Compound Name | 1-bromo-2,5-dimethoxy-4-[(5-methyl-2-nitrophenoxy)methyl]benzene |
|---|---|
| PubChem CID | 36632094 |
| Molecular Formula | C16H16BrNO5 |
| Molecular Weight | 382.21 g/mol |
| Exact Mass | 381.02 |
| IUPAC Name | 1-bromo-2,5-dimethoxy-4-[(5-methyl-2-nitrophenoxy)methyl]benzene |
| SMILES | COc1cc(COc2cc(C)ccc2[N+](=O)[O-])c(OC)cc1Br |
| InChI | InChI=1S/C16H16BrNO5/c1-10-4-5-13(18(19)20)16(6-10)23-9-11-7-15(22-3)12(17)8-14(11)21-2/h4-8H,9H2,1-3H3 |
| InChIKey | KDPPVYSSBWSOBF-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.21 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|