C14H11N3O4S — CID 36632101
5-[(5-methyl-2-nitrophenoxy)methyl]-3-thiophen-2-yl-1,2,4-oxadiazole (PubChem CID 36632101) has the molecular formula C14H11N3O4S and a molecular weight of 317.33 g/mol. Its IUPAC name is 5-[(5-methyl-2-nitrophenoxy)methyl]-3-thiophen-2-yl-1,2,4-oxadiazole.
| Compound Name | 5-[(5-methyl-2-nitrophenoxy)methyl]-3-thiophen-2-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 36632101 |
| Molecular Formula | C14H11N3O4S |
| Molecular Weight | 317.33 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 5-[(5-methyl-2-nitrophenoxy)methyl]-3-thiophen-2-yl-1,2,4-oxadiazole |
| SMILES | Cc1ccc([N+](=O)[O-])c(OCc2nc(-c3cccs3)no2)c1 |
| InChI | InChI=1S/C14H11N3O4S/c1-9-4-5-10(17(18)19)11(7-9)20-8-13-15-14(16-21-13)12-3-2-6-22-12/h2-7H,8H2,1H3 |
| InChIKey | SQLQRQOXBNHICM-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 91.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.33 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|