About 9aH-quinolizine
9aH-quinolizine (PubChem CID 3663753) has the molecular formula C9H9N
and a molecular weight of 131.18 g/mol. Its IUPAC name is 9aH-quinolizine.
Molecular Properties
| Compound Name | 9aH-quinolizine |
| PubChem CID | 3663753 |
| Molecular Formula | C9H9N |
| Molecular Weight | 131.18 g/mol |
| Exact Mass | 131.07 |
| IUPAC Name | 9aH-quinolizine |
| SMILES | C1=CC2C=CC=CN2C=C1 |
| InChI | InChI=1S/C9H9N/c1-3-7-10-8-4-2-6-9(10)5-1/h1-9H |
| InChIKey | JKOSGWKYFINVGX-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.18 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 9aH-quinolizine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9aH-quinolizine?
The IUPAC name of 9aH-quinolizine (CID 3663753) is 9aH-quinolizine.
What is the SMILES notation for 9aH-quinolizine?
The canonical SMILES for 9aH-quinolizine is C1=CC2C=CC=CN2C=C1.
What is the InChIKey of 9aH-quinolizine?
The InChIKey is JKOSGWKYFINVGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N/c1-3-7-10-8-4-2-6-9(10)5-1/h1-9H.
What are the key properties of 9aH-quinolizine?
9aH-quinolizine has a molecular weight of 131.18 g/mol, XLogP of 1.82, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9aH-quinolizine is sourced from PubChem (CID 3663753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).