C14H15N2OP — CID 3663884
3-phenyl-1,2,4,5-tetrahydro-1,5,3λ5-benzodiazaphosphepine 3-oxide (PubChem CID 3663884) has the molecular formula C14H15N2OP and a molecular weight of 258.26 g/mol. Its IUPAC name is 3-phenyl-1,2,4,5-tetrahydro-1,5,3λ5-benzodiazaphosphepine 3-oxide.
| Compound Name | 3-phenyl-1,2,4,5-tetrahydro-1,5,3λ5-benzodiazaphosphepine 3-oxide |
|---|---|
| PubChem CID | 3663884 |
| Molecular Formula | C14H15N2OP |
| Molecular Weight | 258.26 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 3-phenyl-1,2,4,5-tetrahydro-1,5,3λ5-benzodiazaphosphepine 3-oxide |
| SMILES | O=P1(c2ccccc2)CNc2ccccc2NC1 |
| InChI | InChI=1S/C14H15N2OP/c17-18(12-6-2-1-3-7-12)10-15-13-8-4-5-9-14(13)16-11-18/h1-9,15-16H,10-11H2 |
| InChIKey | UWWHQHSYFHVAIW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.26 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_C(2)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|