C24H28N4O4S — CID 36644566
[2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methylamino]-2-oxoethyl] 4-(thiophene-3-carbonylamino)butanoate (PubChem CID 36644566) has the molecular formula C24H28N4O4S and a molecular weight of 468.58 g/mol. Its IUPAC name is [2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methylamino]-2-oxoethyl] 4-(thiophene-3-carbonylamino)butanoate.
| Compound Name | [2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methylamino]-2-oxoethyl] 4-(thiophene-3-carbonylamino)butanoate |
|---|---|
| PubChem CID | 36644566 |
| Molecular Formula | C24H28N4O4S |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | [2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methylamino]-2-oxoethyl] 4-(thiophene-3-carbonylamino)butanoate |
| SMILES | Cc1nn(Cc2ccccc2)c(C)c1CNC(=O)COC(=O)CCCNC(=O)c1ccsc1 |
| InChI | InChI=1S/C24H28N4O4S/c1-17-21(18(2)28(27-17)14-19-7-4-3-5-8-19)13-26-22(29)15-32-23(30)9-6-11-25-24(31)20-10-12-33-16-20/h3-5,7-8,10,12,16H,6,9,11,13-15H2,1-2H3,(H,25,31)(H,26,29) |
| InChIKey | SSNHAULINOGGAS-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|