C28H40N2O6 — CID 3664544
bis[3-(diethylamino)propyl] 2,6-dimethylfuro[2,3-f][1]benzofuran-3,7-dicarboxylate (PubChem CID 3664544) has the molecular formula C28H40N2O6 and a molecular weight of 500.64 g/mol. Its IUPAC name is bis[3-(diethylamino)propyl] 2,6-dimethylfuro[2,3-f][1]benzofuran-3,7-dicarboxylate.
| Compound Name | bis[3-(diethylamino)propyl] 2,6-dimethylfuro[2,3-f][1]benzofuran-3,7-dicarboxylate |
|---|---|
| PubChem CID | 3664544 |
| Molecular Formula | C28H40N2O6 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.29 |
| IUPAC Name | bis[3-(diethylamino)propyl] 2,6-dimethylfuro[2,3-f][1]benzofuran-3,7-dicarboxylate |
| SMILES | CCN(CC)CCCOC(=O)c1c(C)oc2cc3c(C(=O)OCCCN(CC)CC)c(C)oc3cc12 |
| InChI | InChI=1S/C28H40N2O6/c1-7-29(8-2)13-11-15-33-27(31)25-19(5)35-23-18-22-24(17-21(23)25)36-20(6)26(22)28(32)34-16-12-14-30(9-3)10-4/h17-18H,7-16H2,1-6H3 |
| InChIKey | YCZNXXDDCILAMM-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 85.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|