About 4-amino-2,6-dimethylpyridine-3-carboxylic acid
4-amino-2,6-dimethylpyridine-3-carboxylic acid (PubChem CID 3665362) has the molecular formula C8H10N2O2
and a molecular weight of 166.18 g/mol. Its IUPAC name is 4-amino-2,6-dimethylpyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | 4-amino-2,6-dimethylpyridine-3-carboxylic acid |
| PubChem CID | 3665362 |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | 4-amino-2,6-dimethylpyridine-3-carboxylic acid |
| SMILES | Cc1cc(N)c(C(=O)O)c(C)n1 |
| InChI | InChI=1S/C8H10N2O2/c1-4-3-6(9)7(8(11)12)5(2)10-4/h3H,1-2H3,(H2,9,10)(H,11,12) |
| InChIKey | BIJOZKGWGBOUHE-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-amino-2,6-dimethylpyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2,6-dimethylpyridine-3-carboxylic acid?
The IUPAC name of 4-amino-2,6-dimethylpyridine-3-carboxylic acid (CID 3665362) is 4-amino-2,6-dimethylpyridine-3-carboxylic acid.
What is the SMILES notation for 4-amino-2,6-dimethylpyridine-3-carboxylic acid?
The canonical SMILES for 4-amino-2,6-dimethylpyridine-3-carboxylic acid is Cc1cc(N)c(C(=O)O)c(C)n1.
What is the InChIKey of 4-amino-2,6-dimethylpyridine-3-carboxylic acid?
The InChIKey is BIJOZKGWGBOUHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O2/c1-4-3-6(9)7(8(11)12)5(2)10-4/h3H,1-2H3,(H2,9,10)(H,11,12).
What are the key properties of 4-amino-2,6-dimethylpyridine-3-carboxylic acid?
4-amino-2,6-dimethylpyridine-3-carboxylic acid has a molecular weight of 166.18 g/mol, XLogP of 0.98, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2,6-dimethylpyridine-3-carboxylic acid is sourced from PubChem (CID 3665362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).