4-amino-2,6-dimethylpyridine-3-carboxylic acid

C8H10N2O2 — CID 3665362

IUPAC4-amino-2,6-dimethylpyridine-3-carboxylic acid
SMILESCc1cc(N)c(C(=O)O)c(C)n1
InChIInChI=1S/C8H10N2O2/c1-4-3-6(9)7(8(11)12)5(2)10-4/h3H,1-2H3,(H2,9,10)(H,11,12)
InChIKeyBIJOZKGWGBOUHE-UHFFFAOYSA-N
MW166.18 g/mol
LogP0.98
Rot. Bonds1

About 4-amino-2,6-dimethylpyridine-3-carboxylic acid

4-amino-2,6-dimethylpyridine-3-carboxylic acid (PubChem CID 3665362) has the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. Its IUPAC name is 4-amino-2,6-dimethylpyridine-3-carboxylic acid.

Molecular Properties

Compound Name4-amino-2,6-dimethylpyridine-3-carboxylic acid
PubChem CID3665362
Molecular FormulaC8H10N2O2
Molecular Weight166.18 g/mol
Exact Mass166.07
IUPAC Name4-amino-2,6-dimethylpyridine-3-carboxylic acid
SMILESCc1cc(N)c(C(=O)O)c(C)n1
InChIInChI=1S/C8H10N2O2/c1-4-3-6(9)7(8(11)12)5(2)10-4/h3H,1-2H3,(H2,9,10)(H,11,12)
InChIKeyBIJOZKGWGBOUHE-UHFFFAOYSA-N
XLogP0.98
TPSA76.21 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500166.18
LogP ≤ 50.98
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 4-amino-2,6-dimethylpyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-amino-2,6-dimethylpyridine-3-carboxylic acid?
The IUPAC name of 4-amino-2,6-dimethylpyridine-3-carboxylic acid (CID 3665362) is 4-amino-2,6-dimethylpyridine-3-carboxylic acid.
What is the SMILES notation for 4-amino-2,6-dimethylpyridine-3-carboxylic acid?
The canonical SMILES for 4-amino-2,6-dimethylpyridine-3-carboxylic acid is Cc1cc(N)c(C(=O)O)c(C)n1.
What is the InChIKey of 4-amino-2,6-dimethylpyridine-3-carboxylic acid?
The InChIKey is BIJOZKGWGBOUHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O2/c1-4-3-6(9)7(8(11)12)5(2)10-4/h3H,1-2H3,(H2,9,10)(H,11,12).
What are the key properties of 4-amino-2,6-dimethylpyridine-3-carboxylic acid?
4-amino-2,6-dimethylpyridine-3-carboxylic acid has a molecular weight of 166.18 g/mol, XLogP of 0.98, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2,6-dimethylpyridine-3-carboxylic acid is sourced from PubChem (CID 3665362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).