About 1,1-dioxo-1,2-benzothiazol-3-olate
1,1-dioxo-1,2-benzothiazol-3-olate (PubChem CID 3665684) has the molecular formula C7H4NO3S-
and a molecular weight of 182.18 g/mol. Its IUPAC name is 1,1-dioxo-1,2-benzothiazol-3-olate.
Molecular Properties
| Compound Name | 1,1-dioxo-1,2-benzothiazol-3-olate |
| PubChem CID | 3665684 |
| Molecular Formula | C7H4NO3S- |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 181.99 |
| IUPAC Name | 1,1-dioxo-1,2-benzothiazol-3-olate |
| SMILES | O=S1(=O)N=C([O-])c2ccccc21 |
| InChI | InChI=1S/C7H5NO3S/c9-7-5-3-1-2-4-6(5)12(10,11)8-7/h1-4H,(H,8,9)/p-1 |
| InChIKey | CVHZOJJKTDOEJC-UHFFFAOYSA-M |
| XLogP | -0.50 |
| TPSA | 69.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,1-dioxo-1,2-benzothiazol-3-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dioxo-1,2-benzothiazol-3-olate?
The IUPAC name of 1,1-dioxo-1,2-benzothiazol-3-olate (CID 3665684) is 1,1-dioxo-1,2-benzothiazol-3-olate.
What is the SMILES notation for 1,1-dioxo-1,2-benzothiazol-3-olate?
The canonical SMILES for 1,1-dioxo-1,2-benzothiazol-3-olate is O=S1(=O)N=C([O-])c2ccccc21.
What is the InChIKey of 1,1-dioxo-1,2-benzothiazol-3-olate?
The InChIKey is CVHZOJJKTDOEJC-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H5NO3S/c9-7-5-3-1-2-4-6(5)12(10,11)8-7/h1-4H,(H,8,9)/p-1.
What are the key properties of 1,1-dioxo-1,2-benzothiazol-3-olate?
1,1-dioxo-1,2-benzothiazol-3-olate has a molecular weight of 182.18 g/mol, XLogP of -0.50, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dioxo-1,2-benzothiazol-3-olate is sourced from PubChem (CID 3665684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).