About 2-(4-aminophenyl)-N-(1,3-benzodioxol-5-yl)-1,3-oxazole-4-carboxamide
2-(4-aminophenyl)-N-(1,3-benzodioxol-5-yl)-1,3-oxazole-4-carboxamide (PubChem CID 3665721) has the molecular formula C17H13N3O4
and a molecular weight of 323.31 g/mol. Its IUPAC name is 2-(4-aminophenyl)-N-(1,3-benzodioxol-5-yl)-1,3-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | 2-(4-aminophenyl)-N-(1,3-benzodioxol-5-yl)-1,3-oxazole-4-carboxamide |
| PubChem CID | 3665721 |
| Molecular Formula | C17H13N3O4 |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 2-(4-aminophenyl)-N-(1,3-benzodioxol-5-yl)-1,3-oxazole-4-carboxamide |
| SMILES | Nc1ccc(-c2nc(C(=O)Nc3ccc4c(c3)OCO4)co2)cc1 |
| InChI | InChI=1S/C17H13N3O4/c18-11-3-1-10(2-4-11)17-20-13(8-22-17)16(21)19-12-5-6-14-15(7-12)24-9-23-14/h1-8H,9,18H2,(H,19,21) |
| InChIKey | REDVGRVMSLXBLU-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 99.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-aminophenyl)-N-(1,3-benzodioxol-5-yl)-1,3-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-aminophenyl)-N-(1,3-benzodioxol-5-yl)-1,3-oxazole-4-carboxamide?
The IUPAC name of 2-(4-aminophenyl)-N-(1,3-benzodioxol-5-yl)-1,3-oxazole-4-carboxamide (CID 3665721) is 2-(4-aminophenyl)-N-(1,3-benzodioxol-5-yl)-1,3-oxazole-4-carboxamide.
What is the SMILES notation for 2-(4-aminophenyl)-N-(1,3-benzodioxol-5-yl)-1,3-oxazole-4-carboxamide?
The canonical SMILES for 2-(4-aminophenyl)-N-(1,3-benzodioxol-5-yl)-1,3-oxazole-4-carboxamide is Nc1ccc(-c2nc(C(=O)Nc3ccc4c(c3)OCO4)co2)cc1.
What is the InChIKey of 2-(4-aminophenyl)-N-(1,3-benzodioxol-5-yl)-1,3-oxazole-4-carboxamide?
The InChIKey is REDVGRVMSLXBLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13N3O4/c18-11-3-1-10(2-4-11)17-20-13(8-22-17)16(21)19-12-5-6-14-15(7-12)24-9-23-14/h1-8H,9,18H2,(H,19,21).
What are the key properties of 2-(4-aminophenyl)-N-(1,3-benzodioxol-5-yl)-1,3-oxazole-4-carboxamide?
2-(4-aminophenyl)-N-(1,3-benzodioxol-5-yl)-1,3-oxazole-4-carboxamide has a molecular weight of 323.31 g/mol, XLogP of 2.90, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-aminophenyl)-N-(1,3-benzodioxol-5-yl)-1,3-oxazole-4-carboxamide is sourced from PubChem (CID 3665721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).