C20H17BrF3NO — CID 3666639
4-(5-bromo-2-methoxyphenyl)-8-(trifluoromethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 3666639) has the molecular formula C20H17BrF3NO and a molecular weight of 424.26 g/mol. Its IUPAC name is 4-(5-bromo-2-methoxyphenyl)-8-(trifluoromethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | 4-(5-bromo-2-methoxyphenyl)-8-(trifluoromethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 3666639 |
| Molecular Formula | C20H17BrF3NO |
| Molecular Weight | 424.26 g/mol |
| Exact Mass | 423.04 |
| IUPAC Name | 4-(5-bromo-2-methoxyphenyl)-8-(trifluoromethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | COc1ccc(Br)cc1C1Nc2ccc(C(F)(F)F)cc2C2C=CCC21 |
| InChI | InChI=1S/C20H17BrF3NO/c1-26-18-8-6-12(21)10-16(18)19-14-4-2-3-13(14)15-9-11(20(22,23)24)5-7-17(15)25-19/h2-3,5-10,13-14,19,25H,4H2,1H3 |
| InChIKey | BDNLEIWCPBBREO-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.26 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|