C16H15ClN2O2S — CID 3667080
4-chloro-N-(2-cyano-5-methylphenyl)-2,5-dimethylbenzenesulfonamide (PubChem CID 3667080) has the molecular formula C16H15ClN2O2S and a molecular weight of 334.83 g/mol. Its IUPAC name is 4-chloro-N-(2-cyano-5-methylphenyl)-2,5-dimethylbenzenesulfonamide.
| Compound Name | 4-chloro-N-(2-cyano-5-methylphenyl)-2,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 3667080 |
| Molecular Formula | C16H15ClN2O2S |
| Molecular Weight | 334.83 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | 4-chloro-N-(2-cyano-5-methylphenyl)-2,5-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(C#N)c(NS(=O)(=O)c2cc(C)c(Cl)cc2C)c1 |
| InChI | InChI=1S/C16H15ClN2O2S/c1-10-4-5-13(9-18)15(6-10)19-22(20,21)16-8-11(2)14(17)7-12(16)3/h4-8,19H,1-3H3 |
| InChIKey | ZLACXEUHVTUZEC-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.83 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |