C13H19N3O3 — CID 36677443
1-[2-[(2R)-2-ethylpiperidin-1-yl]-2-oxoethyl]pyrimidine-2,4-dione (PubChem CID 36677443) has the molecular formula C13H19N3O3 and a molecular weight of 265.31 g/mol. Its IUPAC name is 1-[2-[(2R)-2-ethylpiperidin-1-yl]-2-oxoethyl]pyrimidine-2,4-dione.
| Compound Name | 1-[2-[(2R)-2-ethylpiperidin-1-yl]-2-oxoethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 36677443 |
| Molecular Formula | C13H19N3O3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | 1-[2-[(2R)-2-ethylpiperidin-1-yl]-2-oxoethyl]pyrimidine-2,4-dione |
| SMILES | CC[C@@H]1CCCCN1C(=O)Cn1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C13H19N3O3/c1-2-10-5-3-4-7-16(10)12(18)9-15-8-6-11(17)14-13(15)19/h6,8,10H,2-5,7,9H2,1H3,(H,14,17,19)/t10-/m1/s1 |
| InChIKey | NEWDPNRHORWZRJ-SNVBAGLBSA-N |
| XLogP | 0.33 |
| TPSA | 75.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |