C21H24N2OS — CID 36678801
2-[[(1S)-2,3-dihydro-1H-inden-1-yl]-methylamino]-N-(2-prop-2-enylsulfanylphenyl)acetamide (PubChem CID 36678801) has the molecular formula C21H24N2OS and a molecular weight of 352.50 g/mol. Its IUPAC name is 2-[[(1S)-2,3-dihydro-1H-inden-1-yl]-methylamino]-N-(2-prop-2-enylsulfanylphenyl)acetamide.
| Compound Name | 2-[[(1S)-2,3-dihydro-1H-inden-1-yl]-methylamino]-N-(2-prop-2-enylsulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 36678801 |
| Molecular Formula | C21H24N2OS |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 2-[[(1S)-2,3-dihydro-1H-inden-1-yl]-methylamino]-N-(2-prop-2-enylsulfanylphenyl)acetamide |
| SMILES | C=CCSc1ccccc1NC(=O)CN(C)[C@H]1CCc2ccccc21 |
| InChI | InChI=1S/C21H24N2OS/c1-3-14-25-20-11-7-6-10-18(20)22-21(24)15-23(2)19-13-12-16-8-4-5-9-17(16)19/h3-11,19H,1,12-15H2,2H3,(H,22,24)/t19-/m0/s1 |
| InChIKey | ZAYIECMNEXXRPQ-IBGZPJMESA-N |
| XLogP | 4.52 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|