About [4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]phenyl] 2-chlorobenzenesulfonate
[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]phenyl] 2-chlorobenzenesulfonate (PubChem CID 3667931) has the molecular formula C19H12Cl2F3NO3S
and a molecular weight of 462.28 g/mol. Its IUPAC name is [4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]phenyl] 2-chlorobenzenesulfonate.
Molecular Properties
| Compound Name | [4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]phenyl] 2-chlorobenzenesulfonate |
| PubChem CID | 3667931 |
| Molecular Formula | C19H12Cl2F3NO3S |
| Molecular Weight | 462.28 g/mol |
| Exact Mass | 460.99 |
| IUPAC Name | [4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]phenyl] 2-chlorobenzenesulfonate |
| SMILES | O=S(=O)(Oc1ccc(Cc2ncc(C(F)(F)F)cc2Cl)cc1)c1ccccc1Cl |
| InChI | InChI=1S/C19H12Cl2F3NO3S/c20-15-3-1-2-4-18(15)29(26,27)28-14-7-5-12(6-8-14)9-17-16(21)10-13(11-25-17)19(22,23)24/h1-8,10-11H,9H2 |
| InChIKey | OGPLTTRCYWFHJK-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 462.28 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]phenyl] 2-chlorobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]phenyl] 2-chlorobenzenesulfonate?
The IUPAC name of [4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]phenyl] 2-chlorobenzenesulfonate (CID 3667931) is [4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]phenyl] 2-chlorobenzenesulfonate.
What is the SMILES notation for [4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]phenyl] 2-chlorobenzenesulfonate?
The canonical SMILES for [4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]phenyl] 2-chlorobenzenesulfonate is O=S(=O)(Oc1ccc(Cc2ncc(C(F)(F)F)cc2Cl)cc1)c1ccccc1Cl.
What is the InChIKey of [4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]phenyl] 2-chlorobenzenesulfonate?
The InChIKey is OGPLTTRCYWFHJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12Cl2F3NO3S/c20-15-3-1-2-4-18(15)29(26,27)28-14-7-5-12(6-8-14)9-17-16(21)10-13(11-25-17)19(22,23)24/h1-8,10-11H,9H2.
What are the key properties of [4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]phenyl] 2-chlorobenzenesulfonate?
[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]phenyl] 2-chlorobenzenesulfonate has a molecular weight of 462.28 g/mol, XLogP of 5.77, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]phenyl] 2-chlorobenzenesulfonate is sourced from PubChem (CID 3667931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).