About 2-[3,5-bis(1H-benzimidazol-2-yl)phenyl]-1H-benzimidazole
2-[3,5-bis(1H-benzimidazol-2-yl)phenyl]-1H-benzimidazole (PubChem CID 3668109) has the molecular formula C27H18N6
and a molecular weight of 426.48 g/mol. Its IUPAC name is 2-[3,5-bis(1H-benzimidazol-2-yl)phenyl]-1H-benzimidazole.
Molecular Properties
| Compound Name | 2-[3,5-bis(1H-benzimidazol-2-yl)phenyl]-1H-benzimidazole |
| PubChem CID | 3668109 |
| Molecular Formula | C27H18N6 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 2-[3,5-bis(1H-benzimidazol-2-yl)phenyl]-1H-benzimidazole |
| SMILES | c1ccc2[nH]c(-c3cc(-c4nc5ccccc5[nH]4)cc(-c4nc5ccccc5[nH]4)c3)nc2c1 |
| InChI | InChI=1S/C27H18N6/c1-2-8-20-19(7-1)28-25(29-20)16-13-17(26-30-21-9-3-4-10-22(21)31-26)15-18(14-16)27-32-23-11-5-6-12-24(23)33-27/h1-15H,(H,28,29)(H,30,31)(H,32,33) |
| InChIKey | GEJNKGHTWHDVTK-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 86.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[3,5-bis(1H-benzimidazol-2-yl)phenyl]-1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,5-bis(1H-benzimidazol-2-yl)phenyl]-1H-benzimidazole?
The IUPAC name of 2-[3,5-bis(1H-benzimidazol-2-yl)phenyl]-1H-benzimidazole (CID 3668109) is 2-[3,5-bis(1H-benzimidazol-2-yl)phenyl]-1H-benzimidazole.
What is the SMILES notation for 2-[3,5-bis(1H-benzimidazol-2-yl)phenyl]-1H-benzimidazole?
The canonical SMILES for 2-[3,5-bis(1H-benzimidazol-2-yl)phenyl]-1H-benzimidazole is c1ccc2[nH]c(-c3cc(-c4nc5ccccc5[nH]4)cc(-c4nc5ccccc5[nH]4)c3)nc2c1.
What is the InChIKey of 2-[3,5-bis(1H-benzimidazol-2-yl)phenyl]-1H-benzimidazole?
The InChIKey is GEJNKGHTWHDVTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H18N6/c1-2-8-20-19(7-1)28-25(29-20)16-13-17(26-30-21-9-3-4-10-22(21)31-26)15-18(14-16)27-32-23-11-5-6-12-24(23)33-27/h1-15H,(H,28,29)(H,30,31)(H,32,33).
What are the key properties of 2-[3,5-bis(1H-benzimidazol-2-yl)phenyl]-1H-benzimidazole?
2-[3,5-bis(1H-benzimidazol-2-yl)phenyl]-1H-benzimidazole has a molecular weight of 426.48 g/mol, XLogP of 6.32, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,5-bis(1H-benzimidazol-2-yl)phenyl]-1H-benzimidazole is sourced from PubChem (CID 3668109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).