C26H37N3O5 — CID 3668392
tert-butyl 2-[4-[1-[2-(2-ethoxyethoxy)ethyl]imidazol-2-yl]piperidine-1-carbonyl]benzoate (PubChem CID 3668392) has the molecular formula C26H37N3O5 and a molecular weight of 471.60 g/mol. Its IUPAC name is tert-butyl 2-[4-[1-[2-(2-ethoxyethoxy)ethyl]imidazol-2-yl]piperidine-1-carbonyl]benzoate.
| Compound Name | tert-butyl 2-[4-[1-[2-(2-ethoxyethoxy)ethyl]imidazol-2-yl]piperidine-1-carbonyl]benzoate |
|---|---|
| PubChem CID | 3668392 |
| Molecular Formula | C26H37N3O5 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.27 |
| IUPAC Name | tert-butyl 2-[4-[1-[2-(2-ethoxyethoxy)ethyl]imidazol-2-yl]piperidine-1-carbonyl]benzoate |
| SMILES | CCOCCOCCn1ccnc1C1CCN(C(=O)c2ccccc2C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C26H37N3O5/c1-5-32-18-19-33-17-16-28-15-12-27-23(28)20-10-13-29(14-11-20)24(30)21-8-6-7-9-22(21)25(31)34-26(2,3)4/h6-9,12,15,20H,5,10-11,13-14,16-19H2,1-4H3 |
| InChIKey | LPCFHKNVHCXNKA-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 82.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|