C20H28NO4+ — CID 36690918
2-(3,4-dimethoxyphenyl)ethyl-[(2R)-2-hydroxy-3-(3-methylphenoxy)propyl]azanium (PubChem CID 36690918) has the molecular formula C20H28NO4+ and a molecular weight of 346.45 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)ethyl-[(2R)-2-hydroxy-3-(3-methylphenoxy)propyl]azanium.
| Compound Name | 2-(3,4-dimethoxyphenyl)ethyl-[(2R)-2-hydroxy-3-(3-methylphenoxy)propyl]azanium |
|---|---|
| PubChem CID | 36690918 |
| Molecular Formula | C20H28NO4+ |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)ethyl-[(2R)-2-hydroxy-3-(3-methylphenoxy)propyl]azanium |
| SMILES | COc1ccc(CC[NH2+]C[C@@H](O)COc2cccc(C)c2)cc1OC |
| InChI | InChI=1S/C20H27NO4/c1-15-5-4-6-18(11-15)25-14-17(22)13-21-10-9-16-7-8-19(23-2)20(12-16)24-3/h4-8,11-12,17,21-22H,9-10,13-14H2,1-3H3/p+1/t17-/m1/s1 |
| InChIKey | HXLAFSUPPDYFEO-QGZVFWFLSA-O |
| XLogP | 1.56 |
| TPSA | 64.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|