About 4,5-dibromo-N-(2,2-diethoxyethyl)thiophene-2-sulfonamide
4,5-dibromo-N-(2,2-diethoxyethyl)thiophene-2-sulfonamide (PubChem CID 3669752) has the molecular formula C10H15Br2NO4S2
and a molecular weight of 437.18 g/mol. Its IUPAC name is 4,5-dibromo-N-(2,2-diethoxyethyl)thiophene-2-sulfonamide.
Molecular Properties
| Compound Name | 4,5-dibromo-N-(2,2-diethoxyethyl)thiophene-2-sulfonamide |
| PubChem CID | 3669752 |
| Molecular Formula | C10H15Br2NO4S2 |
| Molecular Weight | 437.18 g/mol |
| Exact Mass | 434.88 |
| IUPAC Name | 4,5-dibromo-N-(2,2-diethoxyethyl)thiophene-2-sulfonamide |
| SMILES | CCOC(CNS(=O)(=O)c1cc(Br)c(Br)s1)OCC |
| InChI | InChI=1S/C10H15Br2NO4S2/c1-3-16-8(17-4-2)6-13-19(14,15)9-5-7(11)10(12)18-9/h5,8,13H,3-4,6H2,1-2H3 |
| InChIKey | LIBCVIZVCXIALB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.18 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dibromo-N-(2,2-diethoxyethyl)thiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dibromo-N-(2,2-diethoxyethyl)thiophene-2-sulfonamide?
The IUPAC name of 4,5-dibromo-N-(2,2-diethoxyethyl)thiophene-2-sulfonamide (CID 3669752) is 4,5-dibromo-N-(2,2-diethoxyethyl)thiophene-2-sulfonamide.
What is the SMILES notation for 4,5-dibromo-N-(2,2-diethoxyethyl)thiophene-2-sulfonamide?
The canonical SMILES for 4,5-dibromo-N-(2,2-diethoxyethyl)thiophene-2-sulfonamide is CCOC(CNS(=O)(=O)c1cc(Br)c(Br)s1)OCC.
What is the InChIKey of 4,5-dibromo-N-(2,2-diethoxyethyl)thiophene-2-sulfonamide?
The InChIKey is LIBCVIZVCXIALB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15Br2NO4S2/c1-3-16-8(17-4-2)6-13-19(14,15)9-5-7(11)10(12)18-9/h5,8,13H,3-4,6H2,1-2H3.
What are the key properties of 4,5-dibromo-N-(2,2-diethoxyethyl)thiophene-2-sulfonamide?
4,5-dibromo-N-(2,2-diethoxyethyl)thiophene-2-sulfonamide has a molecular weight of 437.18 g/mol, XLogP of 2.95, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dibromo-N-(2,2-diethoxyethyl)thiophene-2-sulfonamide is sourced from PubChem (CID 3669752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).