C22H12ClIN2O2S — CID 3669842
3-chloro-N-[2-(3-iodophenyl)-1,3-benzoxazol-5-yl]-1-benzothiophene-2-carboxamide (PubChem CID 3669842) has the molecular formula C22H12ClIN2O2S and a molecular weight of 530.77 g/mol. Its IUPAC name is 3-chloro-N-[2-(3-iodophenyl)-1,3-benzoxazol-5-yl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[2-(3-iodophenyl)-1,3-benzoxazol-5-yl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 3669842 |
| Molecular Formula | C22H12ClIN2O2S |
| Molecular Weight | 530.77 g/mol |
| Exact Mass | 529.94 |
| IUPAC Name | 3-chloro-N-[2-(3-iodophenyl)-1,3-benzoxazol-5-yl]-1-benzothiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc2oc(-c3cccc(I)c3)nc2c1)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C22H12ClIN2O2S/c23-19-15-6-1-2-7-18(15)29-20(19)21(27)25-14-8-9-17-16(11-14)26-22(28-17)12-4-3-5-13(24)10-12/h1-11H,(H,25,27) |
| InChIKey | DYPHRERHVFUKJR-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.77 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|