C14H9BrF2N2O2 — CID 36702536
N'-(4-bromobenzoyl)-2,6-difluorobenzohydrazide (PubChem CID 36702536) has the molecular formula C14H9BrF2N2O2 and a molecular weight of 355.14 g/mol. Its IUPAC name is N'-(4-bromobenzoyl)-2,6-difluorobenzohydrazide.
| Compound Name | N'-(4-bromobenzoyl)-2,6-difluorobenzohydrazide |
|---|---|
| PubChem CID | 36702536 |
| Molecular Formula | C14H9BrF2N2O2 |
| Molecular Weight | 355.14 g/mol |
| Exact Mass | 353.98 |
| IUPAC Name | N'-(4-bromobenzoyl)-2,6-difluorobenzohydrazide |
| SMILES | O=C(NNC(=O)c1c(F)cccc1F)c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H9BrF2N2O2/c15-9-6-4-8(5-7-9)13(20)18-19-14(21)12-10(16)2-1-3-11(12)17/h1-7H,(H,18,20)(H,19,21) |
| InChIKey | LKVGHUBWUHRWRD-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.14 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|