About 3-(4-iodophenyl)-1,2-oxazol-5-amine
3-(4-iodophenyl)-1,2-oxazol-5-amine (PubChem CID 3670293) has the molecular formula C9H7IN2O
and a molecular weight of 286.07 g/mol. Its IUPAC name is 3-(4-iodophenyl)-1,2-oxazol-5-amine.
Molecular Properties
| Compound Name | 3-(4-iodophenyl)-1,2-oxazol-5-amine |
| PubChem CID | 3670293 |
| Molecular Formula | C9H7IN2O |
| Molecular Weight | 286.07 g/mol |
| Exact Mass | 285.96 |
| IUPAC Name | 3-(4-iodophenyl)-1,2-oxazol-5-amine |
| SMILES | Nc1cc(-c2ccc(I)cc2)no1 |
| InChI | InChI=1S/C9H7IN2O/c10-7-3-1-6(2-4-7)8-5-9(11)13-12-8/h1-5H,11H2 |
| InChIKey | MCHPDUJYVJXRRB-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.07 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-iodophenyl)-1,2-oxazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-iodophenyl)-1,2-oxazol-5-amine?
The IUPAC name of 3-(4-iodophenyl)-1,2-oxazol-5-amine (CID 3670293) is 3-(4-iodophenyl)-1,2-oxazol-5-amine.
What is the SMILES notation for 3-(4-iodophenyl)-1,2-oxazol-5-amine?
The canonical SMILES for 3-(4-iodophenyl)-1,2-oxazol-5-amine is Nc1cc(-c2ccc(I)cc2)no1.
What is the InChIKey of 3-(4-iodophenyl)-1,2-oxazol-5-amine?
The InChIKey is MCHPDUJYVJXRRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7IN2O/c10-7-3-1-6(2-4-7)8-5-9(11)13-12-8/h1-5H,11H2.
What are the key properties of 3-(4-iodophenyl)-1,2-oxazol-5-amine?
3-(4-iodophenyl)-1,2-oxazol-5-amine has a molecular weight of 286.07 g/mol, XLogP of 2.53, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-iodophenyl)-1,2-oxazol-5-amine is sourced from PubChem (CID 3670293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).