C18H16N4O3S — CID 36703614
N'-[4-(3-methyl-1,2,4-oxadiazol-5-yl)benzoyl]-5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbohydrazide (PubChem CID 36703614) has the molecular formula C18H16N4O3S and a molecular weight of 368.42 g/mol. Its IUPAC name is N'-[4-(3-methyl-1,2,4-oxadiazol-5-yl)benzoyl]-5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbohydrazide.
| Compound Name | N'-[4-(3-methyl-1,2,4-oxadiazol-5-yl)benzoyl]-5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 36703614 |
| Molecular Formula | C18H16N4O3S |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | N'-[4-(3-methyl-1,2,4-oxadiazol-5-yl)benzoyl]-5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbohydrazide |
| SMILES | Cc1noc(-c2ccc(C(=O)NNC(=O)c3cc4c(s3)CCC4)cc2)n1 |
| InChI | InChI=1S/C18H16N4O3S/c1-10-19-18(25-22-10)12-7-5-11(6-8-12)16(23)20-21-17(24)15-9-13-3-2-4-14(13)26-15/h5-9H,2-4H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | LYKGLBAQGLUPEN-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|