About (6-bromonaphthalen-2-yl) 2-[(2-cyanophenyl)sulfonyl-methylamino]acetate
(6-bromonaphthalen-2-yl) 2-[(2-cyanophenyl)sulfonyl-methylamino]acetate (PubChem CID 36704414) has the molecular formula C20H15BrN2O4S
and a molecular weight of 459.32 g/mol. Its IUPAC name is (6-bromonaphthalen-2-yl) 2-[(2-cyanophenyl)sulfonyl-methylamino]acetate.
Molecular Properties
| Compound Name | (6-bromonaphthalen-2-yl) 2-[(2-cyanophenyl)sulfonyl-methylamino]acetate |
| PubChem CID | 36704414 |
| Molecular Formula | C20H15BrN2O4S |
| Molecular Weight | 459.32 g/mol |
| Exact Mass | 457.99 |
| IUPAC Name | (6-bromonaphthalen-2-yl) 2-[(2-cyanophenyl)sulfonyl-methylamino]acetate |
| SMILES | CN(CC(=O)Oc1ccc2cc(Br)ccc2c1)S(=O)(=O)c1ccccc1C#N |
| InChI | InChI=1S/C20H15BrN2O4S/c1-23(28(25,26)19-5-3-2-4-16(19)12-22)13-20(24)27-18-9-7-14-10-17(21)8-6-15(14)11-18/h2-11H,13H2,1H3 |
| InChIKey | KAGOALNKJHWLJC-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 459.32 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (6-bromonaphthalen-2-yl) 2-[(2-cyanophenyl)sulfonyl-methylamino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-bromonaphthalen-2-yl) 2-[(2-cyanophenyl)sulfonyl-methylamino]acetate?
The IUPAC name of (6-bromonaphthalen-2-yl) 2-[(2-cyanophenyl)sulfonyl-methylamino]acetate (CID 36704414) is (6-bromonaphthalen-2-yl) 2-[(2-cyanophenyl)sulfonyl-methylamino]acetate.
What is the SMILES notation for (6-bromonaphthalen-2-yl) 2-[(2-cyanophenyl)sulfonyl-methylamino]acetate?
The canonical SMILES for (6-bromonaphthalen-2-yl) 2-[(2-cyanophenyl)sulfonyl-methylamino]acetate is CN(CC(=O)Oc1ccc2cc(Br)ccc2c1)S(=O)(=O)c1ccccc1C#N.
What is the InChIKey of (6-bromonaphthalen-2-yl) 2-[(2-cyanophenyl)sulfonyl-methylamino]acetate?
The InChIKey is KAGOALNKJHWLJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15BrN2O4S/c1-23(28(25,26)19-5-3-2-4-16(19)12-22)13-20(24)27-18-9-7-14-10-17(21)8-6-15(14)11-18/h2-11H,13H2,1H3.
What are the key properties of (6-bromonaphthalen-2-yl) 2-[(2-cyanophenyl)sulfonyl-methylamino]acetate?
(6-bromonaphthalen-2-yl) 2-[(2-cyanophenyl)sulfonyl-methylamino]acetate has a molecular weight of 459.32 g/mol, XLogP of 3.70, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (6-bromonaphthalen-2-yl) 2-[(2-cyanophenyl)sulfonyl-methylamino]acetate is sourced from PubChem (CID 36704414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).