C18H17ClF2N2OS — CID 3671325
2-[2-chloro-4-(dimethylamino)phenyl]-3-[(2,5-difluorophenyl)methyl]-1,3-thiazolidin-4-one (PubChem CID 3671325) has the molecular formula C18H17ClF2N2OS and a molecular weight of 382.86 g/mol. Its IUPAC name is 2-[2-chloro-4-(dimethylamino)phenyl]-3-[(2,5-difluorophenyl)methyl]-1,3-thiazolidin-4-one.
| Compound Name | 2-[2-chloro-4-(dimethylamino)phenyl]-3-[(2,5-difluorophenyl)methyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3671325 |
| Molecular Formula | C18H17ClF2N2OS |
| Molecular Weight | 382.86 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | 2-[2-chloro-4-(dimethylamino)phenyl]-3-[(2,5-difluorophenyl)methyl]-1,3-thiazolidin-4-one |
| SMILES | CN(C)c1ccc(C2SCC(=O)N2Cc2cc(F)ccc2F)c(Cl)c1 |
| InChI | InChI=1S/C18H17ClF2N2OS/c1-22(2)13-4-5-14(15(19)8-13)18-23(17(24)10-25-18)9-11-7-12(20)3-6-16(11)21/h3-8,18H,9-10H2,1-2H3 |
| InChIKey | PDVYTZPIXVCQSJ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.86 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|