C13H10Cl3N3O2 — CID 36715203
5-cyclopropyl-N'-(2,4,6-trichlorophenyl)-1,2-oxazole-3-carbohydrazide (PubChem CID 36715203) has the molecular formula C13H10Cl3N3O2 and a molecular weight of 346.60 g/mol. Its IUPAC name is 5-cyclopropyl-N'-(2,4,6-trichlorophenyl)-1,2-oxazole-3-carbohydrazide.
| Compound Name | 5-cyclopropyl-N'-(2,4,6-trichlorophenyl)-1,2-oxazole-3-carbohydrazide |
|---|---|
| PubChem CID | 36715203 |
| Molecular Formula | C13H10Cl3N3O2 |
| Molecular Weight | 346.60 g/mol |
| Exact Mass | 344.98 |
| IUPAC Name | 5-cyclopropyl-N'-(2,4,6-trichlorophenyl)-1,2-oxazole-3-carbohydrazide |
| SMILES | O=C(NNc1c(Cl)cc(Cl)cc1Cl)c1cc(C2CC2)on1 |
| InChI | InChI=1S/C13H10Cl3N3O2/c14-7-3-8(15)12(9(16)4-7)17-18-13(20)10-5-11(21-19-10)6-1-2-6/h3-6,17H,1-2H2,(H,18,20) |
| InChIKey | SNIDQDLCXNPRDO-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.60 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|