C4H3N7O2 — CID 3671572
3-nitro-[1,2,4]triazolo[5,1-c][1,2,4]triazin-4-amine (PubChem CID 3671572) has the molecular formula C4H3N7O2 and a molecular weight of 181.12 g/mol. Its IUPAC name is 3-nitro-[1,2,4]triazolo[5,1-c][1,2,4]triazin-4-amine.
| Compound Name | 3-nitro-[1,2,4]triazolo[5,1-c][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 3671572 |
| Molecular Formula | C4H3N7O2 |
| Molecular Weight | 181.12 g/mol |
| Exact Mass | 181.03 |
| IUPAC Name | 3-nitro-[1,2,4]triazolo[5,1-c][1,2,4]triazin-4-amine |
| SMILES | Nc1c([N+](=O)[O-])nnc2ncnn12 |
| InChI | InChI=1S/C4H3N7O2/c5-2-3(11(12)13)8-9-4-6-1-7-10(2)4/h1H,5H2 |
| InChIKey | WGXPJGBTFVCERK-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 125.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.12 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|