C13H11F3N4OS2 — CID 3671790
1-(3-prop-2-enylsulfanyl-1,2,4-thiadiazol-5-yl)-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 3671790) has the molecular formula C13H11F3N4OS2 and a molecular weight of 360.39 g/mol. Its IUPAC name is 1-(3-prop-2-enylsulfanyl-1,2,4-thiadiazol-5-yl)-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(3-prop-2-enylsulfanyl-1,2,4-thiadiazol-5-yl)-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 3671790 |
| Molecular Formula | C13H11F3N4OS2 |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.03 |
| IUPAC Name | 1-(3-prop-2-enylsulfanyl-1,2,4-thiadiazol-5-yl)-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | C=CCSc1nsc(NC(=O)Nc2ccc(C(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C13H11F3N4OS2/c1-2-7-22-12-19-11(23-20-12)18-10(21)17-9-5-3-8(4-6-9)13(14,15)16/h2-6H,1,7H2,(H2,17,18,19,20,21) |
| InChIKey | WXQNVUKJPDJPSW-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|