C12H10F2N4OS2 — CID 3671791
1-(2,4-difluorophenyl)-3-(3-prop-2-enylsulfanyl-1,2,4-thiadiazol-5-yl)urea (PubChem CID 3671791) has the molecular formula C12H10F2N4OS2 and a molecular weight of 328.37 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-(3-prop-2-enylsulfanyl-1,2,4-thiadiazol-5-yl)urea.
| Compound Name | 1-(2,4-difluorophenyl)-3-(3-prop-2-enylsulfanyl-1,2,4-thiadiazol-5-yl)urea |
|---|---|
| PubChem CID | 3671791 |
| Molecular Formula | C12H10F2N4OS2 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-(3-prop-2-enylsulfanyl-1,2,4-thiadiazol-5-yl)urea |
| SMILES | C=CCSc1nsc(NC(=O)Nc2ccc(F)cc2F)n1 |
| InChI | InChI=1S/C12H10F2N4OS2/c1-2-5-20-12-17-11(21-18-12)16-10(19)15-9-4-3-7(13)6-8(9)14/h2-4,6H,1,5H2,(H2,15,16,17,18,19) |
| InChIKey | ZSEGABWUJLTOFK-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|