C14H12BrNO3S2 — CID 36724708
methyl 3-[[2-(2-bromophenyl)sulfanylacetyl]amino]thiophene-2-carboxylate (PubChem CID 36724708) has the molecular formula C14H12BrNO3S2 and a molecular weight of 386.29 g/mol. Its IUPAC name is methyl 3-[[2-(2-bromophenyl)sulfanylacetyl]amino]thiophene-2-carboxylate.
| Compound Name | methyl 3-[[2-(2-bromophenyl)sulfanylacetyl]amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 36724708 |
| Molecular Formula | C14H12BrNO3S2 |
| Molecular Weight | 386.29 g/mol |
| Exact Mass | 384.94 |
| IUPAC Name | methyl 3-[[2-(2-bromophenyl)sulfanylacetyl]amino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1NC(=O)CSc1ccccc1Br |
| InChI | InChI=1S/C14H12BrNO3S2/c1-19-14(18)13-10(6-7-20-13)16-12(17)8-21-11-5-3-2-4-9(11)15/h2-7H,8H2,1H3,(H,16,17) |
| InChIKey | COMYNVPFGYLADO-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.29 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |