About N-(2-methoxyphenyl)-2,4-dinitrobenzamide
N-(2-methoxyphenyl)-2,4-dinitrobenzamide (PubChem CID 3672610) has the molecular formula C14H11N3O6
and a molecular weight of 317.26 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-2,4-dinitrobenzamide.
Molecular Properties
| Compound Name | N-(2-methoxyphenyl)-2,4-dinitrobenzamide |
| PubChem CID | 3672610 |
| Molecular Formula | C14H11N3O6 |
| Molecular Weight | 317.26 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | N-(2-methoxyphenyl)-2,4-dinitrobenzamide |
| SMILES | COc1ccccc1NC(=O)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H11N3O6/c1-23-13-5-3-2-4-11(13)15-14(18)10-7-6-9(16(19)20)8-12(10)17(21)22/h2-8H,1H3,(H,15,18) |
| InChIKey | XAUYKEJTKUTLSM-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 124.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.26 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(2-methoxyphenyl)-2,4-dinitrobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methoxyphenyl)-2,4-dinitrobenzamide?
The IUPAC name of N-(2-methoxyphenyl)-2,4-dinitrobenzamide (CID 3672610) is N-(2-methoxyphenyl)-2,4-dinitrobenzamide.
What is the SMILES notation for N-(2-methoxyphenyl)-2,4-dinitrobenzamide?
The canonical SMILES for N-(2-methoxyphenyl)-2,4-dinitrobenzamide is COc1ccccc1NC(=O)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-].
What is the InChIKey of N-(2-methoxyphenyl)-2,4-dinitrobenzamide?
The InChIKey is XAUYKEJTKUTLSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N3O6/c1-23-13-5-3-2-4-11(13)15-14(18)10-7-6-9(16(19)20)8-12(10)17(21)22/h2-8H,1H3,(H,15,18).
What are the key properties of N-(2-methoxyphenyl)-2,4-dinitrobenzamide?
N-(2-methoxyphenyl)-2,4-dinitrobenzamide has a molecular weight of 317.26 g/mol, XLogP of 2.76, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methoxyphenyl)-2,4-dinitrobenzamide is sourced from PubChem (CID 3672610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).