C18H12F4N2O2 — CID 3672642
1-(4-fluorophenyl)-5-methyl-3-[4-(trifluoromethyl)phenyl]pyrazole-4-carboxylic acid (PubChem CID 3672642) has the molecular formula C18H12F4N2O2 and a molecular weight of 364.30 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-5-methyl-3-[4-(trifluoromethyl)phenyl]pyrazole-4-carboxylic acid.
| Compound Name | 1-(4-fluorophenyl)-5-methyl-3-[4-(trifluoromethyl)phenyl]pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 3672642 |
| Molecular Formula | C18H12F4N2O2 |
| Molecular Weight | 364.30 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | 1-(4-fluorophenyl)-5-methyl-3-[4-(trifluoromethyl)phenyl]pyrazole-4-carboxylic acid |
| SMILES | Cc1c(C(=O)O)c(-c2ccc(C(F)(F)F)cc2)nn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C18H12F4N2O2/c1-10-15(17(25)26)16(11-2-4-12(5-3-11)18(20,21)22)23-24(10)14-8-6-13(19)7-9-14/h2-9H,1H3,(H,25,26) |
| InChIKey | RDSMKXUYSIGDLH-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.30 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |