C28H33N3O5 — CID 3672890
N-benzyl-4-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 3672890) has the molecular formula C28H33N3O5 and a molecular weight of 491.59 g/mol. Its IUPAC name is N-benzyl-4-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | N-benzyl-4-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 3672890 |
| Molecular Formula | C28H33N3O5 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.24 |
| IUPAC Name | N-benzyl-4-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | Cc1c(C2C=C(C(=O)NCc3ccccc3)OC(OCCCCO)C2)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C28H33N3O5/c1-20-26(28(34)31(30(20)2)23-13-7-4-8-14-23)22-17-24(36-25(18-22)35-16-10-9-15-32)27(33)29-19-21-11-5-3-6-12-21/h3-8,11-14,17,22,25,32H,9-10,15-16,18-19H2,1-2H3,(H,29,33) |
| InChIKey | IOELSANUODRDKU-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 94.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|