C25H33N3O6 — CID 3672891
4-[2-(4-hydroxybutoxy)-6-(morpholine-4-carbonyl)-3,4-dihydro-2H-pyran-4-yl]-1,5-dimethyl-2-phenylpyrazol-3-one (PubChem CID 3672891) has the molecular formula C25H33N3O6 and a molecular weight of 471.55 g/mol. Its IUPAC name is 4-[2-(4-hydroxybutoxy)-6-(morpholine-4-carbonyl)-3,4-dihydro-2H-pyran-4-yl]-1,5-dimethyl-2-phenylpyrazol-3-one.
| Compound Name | 4-[2-(4-hydroxybutoxy)-6-(morpholine-4-carbonyl)-3,4-dihydro-2H-pyran-4-yl]-1,5-dimethyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 3672891 |
| Molecular Formula | C25H33N3O6 |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | 4-[2-(4-hydroxybutoxy)-6-(morpholine-4-carbonyl)-3,4-dihydro-2H-pyran-4-yl]-1,5-dimethyl-2-phenylpyrazol-3-one |
| SMILES | Cc1c(C2C=C(C(=O)N3CCOCC3)OC(OCCCCO)C2)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C25H33N3O6/c1-18-23(25(31)28(26(18)2)20-8-4-3-5-9-20)19-16-21(24(30)27-10-14-32-15-11-27)34-22(17-19)33-13-7-6-12-29/h3-5,8-9,16,19,22,29H,6-7,10-15,17H2,1-2H3 |
| InChIKey | NZOBTVGGHGCXHD-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|