About [3-[[3-(trifluoromethyl)phenyl]carbamothioylamino]-1,4-dioxan-2-yl] acetate
[3-[[3-(trifluoromethyl)phenyl]carbamothioylamino]-1,4-dioxan-2-yl] acetate (PubChem CID 3673006) has the molecular formula C14H15F3N2O4S
and a molecular weight of 364.35 g/mol. Its IUPAC name is [3-[[3-(trifluoromethyl)phenyl]carbamothioylamino]-1,4-dioxan-2-yl] acetate.
Molecular Properties
| Compound Name | [3-[[3-(trifluoromethyl)phenyl]carbamothioylamino]-1,4-dioxan-2-yl] acetate |
| PubChem CID | 3673006 |
| Molecular Formula | C14H15F3N2O4S |
| Molecular Weight | 364.35 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | [3-[[3-(trifluoromethyl)phenyl]carbamothioylamino]-1,4-dioxan-2-yl] acetate |
| SMILES | CC(=O)OC1OCCOC1NC(=S)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H15F3N2O4S/c1-8(20)23-12-11(21-5-6-22-12)19-13(24)18-10-4-2-3-9(7-10)14(15,16)17/h2-4,7,11-12H,5-6H2,1H3,(H2,18,19,24) |
| InChIKey | RSMCQGMWTWXNOG-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.35 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [3-[[3-(trifluoromethyl)phenyl]carbamothioylamino]-1,4-dioxan-2-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[[3-(trifluoromethyl)phenyl]carbamothioylamino]-1,4-dioxan-2-yl] acetate?
The IUPAC name of [3-[[3-(trifluoromethyl)phenyl]carbamothioylamino]-1,4-dioxan-2-yl] acetate (CID 3673006) is [3-[[3-(trifluoromethyl)phenyl]carbamothioylamino]-1,4-dioxan-2-yl] acetate.
What is the SMILES notation for [3-[[3-(trifluoromethyl)phenyl]carbamothioylamino]-1,4-dioxan-2-yl] acetate?
The canonical SMILES for [3-[[3-(trifluoromethyl)phenyl]carbamothioylamino]-1,4-dioxan-2-yl] acetate is CC(=O)OC1OCCOC1NC(=S)Nc1cccc(C(F)(F)F)c1.
What is the InChIKey of [3-[[3-(trifluoromethyl)phenyl]carbamothioylamino]-1,4-dioxan-2-yl] acetate?
The InChIKey is RSMCQGMWTWXNOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15F3N2O4S/c1-8(20)23-12-11(21-5-6-22-12)19-13(24)18-10-4-2-3-9(7-10)14(15,16)17/h2-4,7,11-12H,5-6H2,1H3,(H2,18,19,24).
What are the key properties of [3-[[3-(trifluoromethyl)phenyl]carbamothioylamino]-1,4-dioxan-2-yl] acetate?
[3-[[3-(trifluoromethyl)phenyl]carbamothioylamino]-1,4-dioxan-2-yl] acetate has a molecular weight of 364.35 g/mol, XLogP of 2.25, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[[3-(trifluoromethyl)phenyl]carbamothioylamino]-1,4-dioxan-2-yl] acetate is sourced from PubChem (CID 3673006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).