About N-tert-butyl-1-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonamide
N-tert-butyl-1-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonamide (PubChem CID 3673369) has the molecular formula C14H25NO3S
and a molecular weight of 287.42 g/mol. Its IUPAC name is N-tert-butyl-1-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonamide.
Molecular Properties
| Compound Name | N-tert-butyl-1-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonamide |
| PubChem CID | 3673369 |
| Molecular Formula | C14H25NO3S |
| Molecular Weight | 287.42 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | N-tert-butyl-1-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonamide |
| SMILES | CC(C)(C)NS(=O)(=O)CC12CCC(CC1=O)C2(C)C |
| InChI | InChI=1S/C14H25NO3S/c1-12(2,3)15-19(17,18)9-14-7-6-10(8-11(14)16)13(14,4)5/h10,15H,6-9H2,1-5H3 |
| InChIKey | IHDJAEPYFYKDLJ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.42 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-tert-butyl-1-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-1-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonamide?
The IUPAC name of N-tert-butyl-1-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonamide (CID 3673369) is N-tert-butyl-1-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonamide.
What is the SMILES notation for N-tert-butyl-1-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonamide?
The canonical SMILES for N-tert-butyl-1-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonamide is CC(C)(C)NS(=O)(=O)CC12CCC(CC1=O)C2(C)C.
What is the InChIKey of N-tert-butyl-1-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonamide?
The InChIKey is IHDJAEPYFYKDLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25NO3S/c1-12(2,3)15-19(17,18)9-14-7-6-10(8-11(14)16)13(14,4)5/h10,15H,6-9H2,1-5H3.
What are the key properties of N-tert-butyl-1-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonamide?
N-tert-butyl-1-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonamide has a molecular weight of 287.42 g/mol, XLogP of 2.10, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-1-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonamide is sourced from PubChem (CID 3673369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).