C14H17Br3N2O — CID 3673629
N-(2,2,2-tribromo-1-phenylethyl)piperidine-1-carboxamide (PubChem CID 3673629) has the molecular formula C14H17Br3N2O and a molecular weight of 469.02 g/mol. Its IUPAC name is N-(2,2,2-tribromo-1-phenylethyl)piperidine-1-carboxamide.
| Compound Name | N-(2,2,2-tribromo-1-phenylethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 3673629 |
| Molecular Formula | C14H17Br3N2O |
| Molecular Weight | 469.02 g/mol |
| Exact Mass | 465.89 |
| IUPAC Name | N-(2,2,2-tribromo-1-phenylethyl)piperidine-1-carboxamide |
| SMILES | O=C(NC(c1ccccc1)C(Br)(Br)Br)N1CCCCC1 |
| InChI | InChI=1S/C14H17Br3N2O/c15-14(16,17)12(11-7-3-1-4-8-11)18-13(20)19-9-5-2-6-10-19/h1,3-4,7-8,12H,2,5-6,9-10H2,(H,18,20) |
| InChIKey | MPYQBAXMDFZCGV-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.02 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|