C20H19FN2O3 — CID 36737030
2-[2-[(2S)-2-(4-fluorophenyl)morpholin-4-yl]ethyl]isoindole-1,3-dione (PubChem CID 36737030) has the molecular formula C20H19FN2O3 and a molecular weight of 354.38 g/mol. Its IUPAC name is 2-[2-[(2S)-2-(4-fluorophenyl)morpholin-4-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[(2S)-2-(4-fluorophenyl)morpholin-4-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 36737030 |
| Molecular Formula | C20H19FN2O3 |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 2-[2-[(2S)-2-(4-fluorophenyl)morpholin-4-yl]ethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCN1CCO[C@@H](c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C20H19FN2O3/c21-15-7-5-14(6-8-15)18-13-22(11-12-26-18)9-10-23-19(24)16-3-1-2-4-17(16)20(23)25/h1-8,18H,9-13H2/t18-/m1/s1 |
| InChIKey | HWHAFLISNBWSHL-GOSISDBHSA-N |
| XLogP | 2.50 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|