About 2-[[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]iminomethyl]phenol
2-[[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]iminomethyl]phenol (PubChem CID 3674144) has the molecular formula C19H13N3O2
and a molecular weight of 315.33 g/mol. Its IUPAC name is 2-[[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]iminomethyl]phenol.
Molecular Properties
| Compound Name | 2-[[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]iminomethyl]phenol |
| PubChem CID | 3674144 |
| Molecular Formula | C19H13N3O2 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 2-[[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]iminomethyl]phenol |
| SMILES | Oc1ccccc1/C=N/c1cccc(-c2nc3ncccc3o2)c1 |
| InChI | InChI=1S/C19H13N3O2/c23-16-8-2-1-5-14(16)12-21-15-7-3-6-13(11-15)19-22-18-17(24-19)9-4-10-20-18/h1-12,23H/b21-12+ |
| InChIKey | SYSLMKYHMWIVOG-CIAFOILYSA-N |
| XLogP | 4.35 |
| TPSA | 71.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]iminomethyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]iminomethyl]phenol?
The IUPAC name of 2-[[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]iminomethyl]phenol (CID 3674144) is 2-[[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]iminomethyl]phenol.
What is the SMILES notation for 2-[[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]iminomethyl]phenol?
The canonical SMILES for 2-[[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]iminomethyl]phenol is Oc1ccccc1/C=N/c1cccc(-c2nc3ncccc3o2)c1.
What is the InChIKey of 2-[[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]iminomethyl]phenol?
The InChIKey is SYSLMKYHMWIVOG-CIAFOILYSA-N. The full InChI is InChI=1S/C19H13N3O2/c23-16-8-2-1-5-14(16)12-21-15-7-3-6-13(11-15)19-22-18-17(24-19)9-4-10-20-18/h1-12,23H/b21-12+.
What are the key properties of 2-[[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]iminomethyl]phenol?
2-[[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]iminomethyl]phenol has a molecular weight of 315.33 g/mol, XLogP of 4.35, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]iminomethyl]phenol is sourced from PubChem (CID 3674144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).