C11H18N2O — CID 3674285
2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydropyrido[3,4-b]indol-1-one (PubChem CID 3674285) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydropyrido[3,4-b]indol-1-one.
| Compound Name | 2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydropyrido[3,4-b]indol-1-one |
|---|---|
| PubChem CID | 3674285 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydropyrido[3,4-b]indol-1-one |
| SMILES | O=C1NCCC2C1NC1CCCCC12 |
| InChI | InChI=1S/C11H18N2O/c14-11-10-8(5-6-12-11)7-3-1-2-4-9(7)13-10/h7-10,13H,1-6H2,(H,12,14) |
| InChIKey | LTPHXTBFEHIJRL-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |