About 2-(1-amino-2-hydroxypropyl)-N-(3,4-dimethoxyphenyl)-1,3-oxazole-4-carboxamide
2-(1-amino-2-hydroxypropyl)-N-(3,4-dimethoxyphenyl)-1,3-oxazole-4-carboxamide (PubChem CID 3674321) has the molecular formula C15H19N3O5
and a molecular weight of 321.33 g/mol. Its IUPAC name is 2-(1-amino-2-hydroxypropyl)-N-(3,4-dimethoxyphenyl)-1,3-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | 2-(1-amino-2-hydroxypropyl)-N-(3,4-dimethoxyphenyl)-1,3-oxazole-4-carboxamide |
| PubChem CID | 3674321 |
| Molecular Formula | C15H19N3O5 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 2-(1-amino-2-hydroxypropyl)-N-(3,4-dimethoxyphenyl)-1,3-oxazole-4-carboxamide |
| SMILES | COc1ccc(NC(=O)c2coc(C(N)C(C)O)n2)cc1OC |
| InChI | InChI=1S/C15H19N3O5/c1-8(19)13(16)15-18-10(7-23-15)14(20)17-9-4-5-11(21-2)12(6-9)22-3/h4-8,13,19H,16H2,1-3H3,(H,17,20) |
| InChIKey | LXLKZDZWDSRGTE-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 119.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-(1-amino-2-hydroxypropyl)-N-(3,4-dimethoxyphenyl)-1,3-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-amino-2-hydroxypropyl)-N-(3,4-dimethoxyphenyl)-1,3-oxazole-4-carboxamide?
The IUPAC name of 2-(1-amino-2-hydroxypropyl)-N-(3,4-dimethoxyphenyl)-1,3-oxazole-4-carboxamide (CID 3674321) is 2-(1-amino-2-hydroxypropyl)-N-(3,4-dimethoxyphenyl)-1,3-oxazole-4-carboxamide.
What is the SMILES notation for 2-(1-amino-2-hydroxypropyl)-N-(3,4-dimethoxyphenyl)-1,3-oxazole-4-carboxamide?
The canonical SMILES for 2-(1-amino-2-hydroxypropyl)-N-(3,4-dimethoxyphenyl)-1,3-oxazole-4-carboxamide is COc1ccc(NC(=O)c2coc(C(N)C(C)O)n2)cc1OC.
What is the InChIKey of 2-(1-amino-2-hydroxypropyl)-N-(3,4-dimethoxyphenyl)-1,3-oxazole-4-carboxamide?
The InChIKey is LXLKZDZWDSRGTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3O5/c1-8(19)13(16)15-18-10(7-23-15)14(20)17-9-4-5-11(21-2)12(6-9)22-3/h4-8,13,19H,16H2,1-3H3,(H,17,20).
What are the key properties of 2-(1-amino-2-hydroxypropyl)-N-(3,4-dimethoxyphenyl)-1,3-oxazole-4-carboxamide?
2-(1-amino-2-hydroxypropyl)-N-(3,4-dimethoxyphenyl)-1,3-oxazole-4-carboxamide has a molecular weight of 321.33 g/mol, XLogP of 1.32, 6 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-amino-2-hydroxypropyl)-N-(3,4-dimethoxyphenyl)-1,3-oxazole-4-carboxamide is sourced from PubChem (CID 3674321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).