C16H19N3O4 — CID 3674328
N-(3,4-dimethoxyphenyl)-2-pyrrolidin-2-yl-1,3-oxazole-4-carboxamide (PubChem CID 3674328) has the molecular formula C16H19N3O4 and a molecular weight of 317.35 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-2-pyrrolidin-2-yl-1,3-oxazole-4-carboxamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-2-pyrrolidin-2-yl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 3674328 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-2-pyrrolidin-2-yl-1,3-oxazole-4-carboxamide |
| SMILES | COc1ccc(NC(=O)c2coc(C3CCCN3)n2)cc1OC |
| InChI | InChI=1S/C16H19N3O4/c1-21-13-6-5-10(8-14(13)22-2)18-15(20)12-9-23-16(19-12)11-4-3-7-17-11/h5-6,8-9,11,17H,3-4,7H2,1-2H3,(H,18,20) |
| InChIKey | XNOSYIMYNUWXIO-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 85.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |