C22H20F3N2O3S+ — CID 3674683
[3-(1,3-benzothiazol-2-yl)-6-ethyl-7-hydroxy-4-oxo-2-(trifluoromethyl)chromen-8-yl]methyl-dimethylazanium (PubChem CID 3674683) has the molecular formula C22H20F3N2O3S+ and a molecular weight of 449.47 g/mol. Its IUPAC name is [3-(1,3-benzothiazol-2-yl)-6-ethyl-7-hydroxy-4-oxo-2-(trifluoromethyl)chromen-8-yl]methyl-dimethylazanium.
| Compound Name | [3-(1,3-benzothiazol-2-yl)-6-ethyl-7-hydroxy-4-oxo-2-(trifluoromethyl)chromen-8-yl]methyl-dimethylazanium |
|---|---|
| PubChem CID | 3674683 |
| Molecular Formula | C22H20F3N2O3S+ |
| Molecular Weight | 449.47 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | [3-(1,3-benzothiazol-2-yl)-6-ethyl-7-hydroxy-4-oxo-2-(trifluoromethyl)chromen-8-yl]methyl-dimethylazanium |
| SMILES | CCc1cc2c(=O)c(-c3nc4ccccc4s3)c(C(F)(F)F)oc2c(C[NH+](C)C)c1O |
| InChI | InChI=1S/C22H19F3N2O3S/c1-4-11-9-12-18(29)16(21-26-14-7-5-6-8-15(14)31-21)20(22(23,24)25)30-19(12)13(17(11)28)10-27(2)3/h5-9,28H,4,10H2,1-3H3/p+1 |
| InChIKey | AMMYPDPRRHQRTJ-UHFFFAOYSA-O |
| XLogP | 4.00 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.47 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|