About [2-(1-adamantylamino)-2-oxoethyl] furan-2-carboxylate
[2-(1-adamantylamino)-2-oxoethyl] furan-2-carboxylate (PubChem CID 3674692) has the molecular formula C17H21NO4
and a molecular weight of 303.36 g/mol. Its IUPAC name is [2-(1-adamantylamino)-2-oxoethyl] furan-2-carboxylate.
Molecular Properties
| Compound Name | [2-(1-adamantylamino)-2-oxoethyl] furan-2-carboxylate |
| PubChem CID | 3674692 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | [2-(1-adamantylamino)-2-oxoethyl] furan-2-carboxylate |
| SMILES | O=C(COC(=O)c1ccco1)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C17H21NO4/c19-15(10-22-16(20)14-2-1-3-21-14)18-17-7-11-4-12(8-17)6-13(5-11)9-17/h1-3,11-13H,4-10H2,(H,18,19) |
| InChIKey | PLOMIVOHXDIJSN-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(1-adamantylamino)-2-oxoethyl] furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1-adamantylamino)-2-oxoethyl] furan-2-carboxylate?
The IUPAC name of [2-(1-adamantylamino)-2-oxoethyl] furan-2-carboxylate (CID 3674692) is [2-(1-adamantylamino)-2-oxoethyl] furan-2-carboxylate.
What is the SMILES notation for [2-(1-adamantylamino)-2-oxoethyl] furan-2-carboxylate?
The canonical SMILES for [2-(1-adamantylamino)-2-oxoethyl] furan-2-carboxylate is O=C(COC(=O)c1ccco1)NC12CC3CC(CC(C3)C1)C2.
What is the InChIKey of [2-(1-adamantylamino)-2-oxoethyl] furan-2-carboxylate?
The InChIKey is PLOMIVOHXDIJSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21NO4/c19-15(10-22-16(20)14-2-1-3-21-14)18-17-7-11-4-12(8-17)6-13(5-11)9-17/h1-3,11-13H,4-10H2,(H,18,19).
What are the key properties of [2-(1-adamantylamino)-2-oxoethyl] furan-2-carboxylate?
[2-(1-adamantylamino)-2-oxoethyl] furan-2-carboxylate has a molecular weight of 303.36 g/mol, XLogP of 2.52, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1-adamantylamino)-2-oxoethyl] furan-2-carboxylate is sourced from PubChem (CID 3674692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).