C18H15F3N4O3S — CID 36748773
2-[[5-(furan-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[4-(trifluoromethoxy)phenyl]acetamide (PubChem CID 36748773) has the molecular formula C18H15F3N4O3S and a molecular weight of 424.40 g/mol. Its IUPAC name is 2-[[5-(furan-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[4-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | 2-[[5-(furan-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[4-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 36748773 |
| Molecular Formula | C18H15F3N4O3S |
| Molecular Weight | 424.40 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | 2-[[5-(furan-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[4-(trifluoromethoxy)phenyl]acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2ccc(OC(F)(F)F)cc2)nnc1-c1ccco1 |
| InChI | InChI=1S/C18H15F3N4O3S/c1-2-9-25-16(14-4-3-10-27-14)23-24-17(25)29-11-15(26)22-12-5-7-13(8-6-12)28-18(19,20)21/h2-8,10H,1,9,11H2,(H,22,26) |
| InChIKey | OGTGPLKNMGNJEZ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.40 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|