C21H16Cl3N3O2S3 — CID 3675138
4-[2-[4-(5-chlorothiophen-2-yl)-2-(2,5-dichlorophenyl)imino-1,3-thiazol-3-yl]ethyl]benzenesulfonamide (PubChem CID 3675138) has the molecular formula C21H16Cl3N3O2S3 and a molecular weight of 544.94 g/mol. Its IUPAC name is 4-[2-[4-(5-chlorothiophen-2-yl)-2-(2,5-dichlorophenyl)imino-1,3-thiazol-3-yl]ethyl]benzenesulfonamide.
| Compound Name | 4-[2-[4-(5-chlorothiophen-2-yl)-2-(2,5-dichlorophenyl)imino-1,3-thiazol-3-yl]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 3675138 |
| Molecular Formula | C21H16Cl3N3O2S3 |
| Molecular Weight | 544.94 g/mol |
| Exact Mass | 542.95 |
| IUPAC Name | 4-[2-[4-(5-chlorothiophen-2-yl)-2-(2,5-dichlorophenyl)imino-1,3-thiazol-3-yl]ethyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CCn2c(-c3ccc(Cl)s3)cs/c2=N\c2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C21H16Cl3N3O2S3/c22-14-3-6-16(23)17(11-14)26-21-27(18(12-30-21)19-7-8-20(24)31-19)10-9-13-1-4-15(5-2-13)32(25,28)29/h1-8,11-12H,9-10H2,(H2,25,28,29)/b26-21- |
| InChIKey | RDOLFZLAIGFOTR-QLYXXIJNSA-N |
| XLogP | 6.36 |
| TPSA | 77.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.94 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|